C16H13FIN3O2 — CID 141427172
ethyl 6-cyano-2-(2-fluoro-4-iodoanilino)-5-methylpyridine-3-carboxylate (PubChem CID 141427172) has the molecular formula C16H13FIN3O2 and a molecular weight of 425.20 g/mol. Its IUPAC name is ethyl 6-cyano-2-(2-fluoro-4-iodoanilino)-5-methylpyridine-3-carboxylate.
| Compound Name | ethyl 6-cyano-2-(2-fluoro-4-iodoanilino)-5-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 141427172 |
| Molecular Formula | C16H13FIN3O2 |
| Molecular Weight | 425.20 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | ethyl 6-cyano-2-(2-fluoro-4-iodoanilino)-5-methylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C)c(C#N)nc1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C16H13FIN3O2/c1-3-23-16(22)11-6-9(2)14(8-19)21-15(11)20-13-5-4-10(18)7-12(13)17/h4-7H,3H2,1-2H3,(H,20,21) |
| InChIKey | GHCSFIIOWUPDEB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.20 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|