C17H14FIN2O4 — CID 141423481
ethyl 6-(2-fluoro-4-iodoanilino)-3-methyl-4-oxo-5H-furo[3,2-c]pyridine-7-carboxylate (PubChem CID 141423481) has the molecular formula C17H14FIN2O4 and a molecular weight of 456.21 g/mol. Its IUPAC name is ethyl 6-(2-fluoro-4-iodoanilino)-3-methyl-4-oxo-5H-furo[3,2-c]pyridine-7-carboxylate.
| Compound Name | ethyl 6-(2-fluoro-4-iodoanilino)-3-methyl-4-oxo-5H-furo[3,2-c]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 141423481 |
| Molecular Formula | C17H14FIN2O4 |
| Molecular Weight | 456.21 g/mol |
| Exact Mass | 456.00 |
| IUPAC Name | ethyl 6-(2-fluoro-4-iodoanilino)-3-methyl-4-oxo-5H-furo[3,2-c]pyridine-7-carboxylate |
| SMILES | CCOC(=O)c1c(Nc2ccc(I)cc2F)[nH]c(=O)c2c(C)coc12 |
| InChI | InChI=1S/C17H14FIN2O4/c1-3-24-17(23)13-14-12(8(2)7-25-14)16(22)21-15(13)20-11-5-4-9(19)6-10(11)18/h4-7H,3H2,1-2H3,(H2,20,21,22) |
| InChIKey | CRJHILLCWWJESE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.21 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|