C12H10INO4 — CID 86731085
ethyl 3-hydroxy-6-iodo-2-oxo-1H-quinoline-4-carboxylate (PubChem CID 86731085) has the molecular formula C12H10INO4 and a molecular weight of 359.12 g/mol. Its IUPAC name is ethyl 3-hydroxy-6-iodo-2-oxo-1H-quinoline-4-carboxylate.
| Compound Name | ethyl 3-hydroxy-6-iodo-2-oxo-1H-quinoline-4-carboxylate |
|---|---|
| PubChem CID | 86731085 |
| Molecular Formula | C12H10INO4 |
| Molecular Weight | 359.12 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | ethyl 3-hydroxy-6-iodo-2-oxo-1H-quinoline-4-carboxylate |
| SMILES | CCOC(=O)c1c(O)c(=O)[nH]c2ccc(I)cc12 |
| InChI | InChI=1S/C12H10INO4/c1-2-18-12(17)9-7-5-6(13)3-4-8(7)14-11(16)10(9)15/h3-5,15H,2H2,1H3,(H,14,16) |
| InChIKey | QCZFCLXTACUTII-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.12 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|