C16H13FIN5O2 — CID 59026787
ethyl 3-[3-(2-fluoro-4-iodoanilino)-4-pyridinyl]-1H-1,2,4-triazole-5-carboxylate (PubChem CID 59026787) has the molecular formula C16H13FIN5O2 and a molecular weight of 453.22 g/mol. Its IUPAC name is ethyl 3-[3-(2-fluoro-4-iodoanilino)-4-pyridinyl]-1H-1,2,4-triazole-5-carboxylate.
| Compound Name | ethyl 3-[3-(2-fluoro-4-iodoanilino)-4-pyridinyl]-1H-1,2,4-triazole-5-carboxylate |
|---|---|
| PubChem CID | 59026787 |
| Molecular Formula | C16H13FIN5O2 |
| Molecular Weight | 453.22 g/mol |
| Exact Mass | 453.01 |
| IUPAC Name | ethyl 3-[3-(2-fluoro-4-iodoanilino)-4-pyridinyl]-1H-1,2,4-triazole-5-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2ccncc2Nc2ccc(I)cc2F)n[nH]1 |
| InChI | InChI=1S/C16H13FIN5O2/c1-2-25-16(24)15-21-14(22-23-15)10-5-6-19-8-13(10)20-12-4-3-9(18)7-11(12)17/h3-8,20H,2H2,1H3,(H,21,22,23) |
| InChIKey | XIVIJZJSEIAGPO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|