C11H11IN4O2 — CID 66287784
ethyl 3-(2-amino-5-iodophenyl)-1H-1,2,4-triazole-5-carboxylate (PubChem CID 66287784) has the molecular formula C11H11IN4O2 and a molecular weight of 358.14 g/mol. Its IUPAC name is ethyl 3-(2-amino-5-iodophenyl)-1H-1,2,4-triazole-5-carboxylate.
| Compound Name | ethyl 3-(2-amino-5-iodophenyl)-1H-1,2,4-triazole-5-carboxylate |
|---|---|
| PubChem CID | 66287784 |
| Molecular Formula | C11H11IN4O2 |
| Molecular Weight | 358.14 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | ethyl 3-(2-amino-5-iodophenyl)-1H-1,2,4-triazole-5-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2cc(I)ccc2N)n[nH]1 |
| InChI | InChI=1S/C11H11IN4O2/c1-2-18-11(17)10-14-9(15-16-10)7-5-6(12)3-4-8(7)13/h3-5H,2,13H2,1H3,(H,14,15,16) |
| InChIKey | LOULUDFNZJZQQO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.14 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|