C16H15FIN5O3 — CID 68852573
ethyl 2-amino-2-[[3-(2-fluoro-4-iodoanilino)pyridine-4-carbonyl]hydrazinylidene]acetate (PubChem CID 68852573) has the molecular formula C16H15FIN5O3 and a molecular weight of 471.23 g/mol. Its IUPAC name is ethyl 2-amino-2-[[3-(2-fluoro-4-iodoanilino)pyridine-4-carbonyl]hydrazinylidene]acetate.
| Compound Name | ethyl 2-amino-2-[[3-(2-fluoro-4-iodoanilino)pyridine-4-carbonyl]hydrazinylidene]acetate |
|---|---|
| PubChem CID | 68852573 |
| Molecular Formula | C16H15FIN5O3 |
| Molecular Weight | 471.23 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | ethyl 2-amino-2-[[3-(2-fluoro-4-iodoanilino)pyridine-4-carbonyl]hydrazinylidene]acetate |
| SMILES | CCOC(=O)C(N)=NNC(=O)c1ccncc1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C16H15FIN5O3/c1-2-26-16(25)14(19)22-23-15(24)10-5-6-20-8-13(10)21-12-4-3-9(18)7-11(12)17/h3-8,21H,2H2,1H3,(H2,19,22)(H,23,24) |
| InChIKey | GFWBCPBCDVSJPG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 118.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|