C20H22FIN4O3 — CID 164538746
tert-butyl 3-[[3-(2-fluoro-4-iodoanilino)pyridine-4-carbonyl]amino]azetidine-1-carboxylate (PubChem CID 164538746) has the molecular formula C20H22FIN4O3 and a molecular weight of 512.32 g/mol. Its IUPAC name is tert-butyl 3-[[3-(2-fluoro-4-iodoanilino)pyridine-4-carbonyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[3-(2-fluoro-4-iodoanilino)pyridine-4-carbonyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 164538746 |
| Molecular Formula | C20H22FIN4O3 |
| Molecular Weight | 512.32 g/mol |
| Exact Mass | 512.07 |
| IUPAC Name | tert-butyl 3-[[3-(2-fluoro-4-iodoanilino)pyridine-4-carbonyl]amino]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(NC(=O)c2ccncc2Nc2ccc(I)cc2F)C1 |
| InChI | InChI=1S/C20H22FIN4O3/c1-20(2,3)29-19(28)26-10-13(11-26)24-18(27)14-6-7-23-9-17(14)25-16-5-4-12(22)8-15(16)21/h4-9,13,25H,10-11H2,1-3H3,(H,24,27) |
| InChIKey | OZYWPKMTJMYWQL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|