C13H11FIN5OS — CID 59026765
[[3-(2-fluoro-4-iodoanilino)pyridine-4-carbonyl]amino]thiourea (PubChem CID 59026765) has the molecular formula C13H11FIN5OS and a molecular weight of 431.23 g/mol. Its IUPAC name is [[3-(2-fluoro-4-iodoanilino)pyridine-4-carbonyl]amino]thiourea.
| Compound Name | [[3-(2-fluoro-4-iodoanilino)pyridine-4-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 59026765 |
| Molecular Formula | C13H11FIN5OS |
| Molecular Weight | 431.23 g/mol |
| Exact Mass | 430.97 |
| IUPAC Name | [[3-(2-fluoro-4-iodoanilino)pyridine-4-carbonyl]amino]thiourea |
| SMILES | NC(=S)NNC(=O)c1ccncc1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C13H11FIN5OS/c14-9-5-7(15)1-2-10(9)18-11-6-17-4-3-8(11)12(21)19-20-13(16)22/h1-6,18H,(H,19,21)(H3,16,20,22) |
| InChIKey | SNKLJBHKZQKXMA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|