C19H15ClIN3O2 — CID 11677348
3-(2-chloro-4-iodoanilino)-N-phenylmethoxypyridine-4-carboxamide (PubChem CID 11677348) has the molecular formula C19H15ClIN3O2 and a molecular weight of 479.71 g/mol. Its IUPAC name is 3-(2-chloro-4-iodoanilino)-N-phenylmethoxypyridine-4-carboxamide.
| Compound Name | 3-(2-chloro-4-iodoanilino)-N-phenylmethoxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 11677348 |
| Molecular Formula | C19H15ClIN3O2 |
| Molecular Weight | 479.71 g/mol |
| Exact Mass | 478.99 |
| IUPAC Name | 3-(2-chloro-4-iodoanilino)-N-phenylmethoxypyridine-4-carboxamide |
| SMILES | O=C(NOCc1ccccc1)c1ccncc1Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C19H15ClIN3O2/c20-16-10-14(21)6-7-17(16)23-18-11-22-9-8-15(18)19(25)24-26-12-13-4-2-1-3-5-13/h1-11,23H,12H2,(H,24,25) |
| InChIKey | GXKLGONIHMFDJN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.71 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|