C21H15FIN3O3 — CID 25013801
3-(2-fluoro-4-iodoanilino)-N-phenylmethoxyfuro[3,2-c]pyridine-2-carboxamide (PubChem CID 25013801) has the molecular formula C21H15FIN3O3 and a molecular weight of 503.27 g/mol. Its IUPAC name is 3-(2-fluoro-4-iodoanilino)-N-phenylmethoxyfuro[3,2-c]pyridine-2-carboxamide.
| Compound Name | 3-(2-fluoro-4-iodoanilino)-N-phenylmethoxyfuro[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 25013801 |
| Molecular Formula | C21H15FIN3O3 |
| Molecular Weight | 503.27 g/mol |
| Exact Mass | 503.01 |
| IUPAC Name | 3-(2-fluoro-4-iodoanilino)-N-phenylmethoxyfuro[3,2-c]pyridine-2-carboxamide |
| SMILES | O=C(NOCc1ccccc1)c1oc2ccncc2c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C21H15FIN3O3/c22-16-10-14(23)6-7-17(16)25-19-15-11-24-9-8-18(15)29-20(19)21(27)26-28-12-13-4-2-1-3-5-13/h1-11,25H,12H2,(H,26,27) |
| InChIKey | YYSYZXLKBHAFQP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.27 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|