C17H14FIN4O5 — CID 59704749
3-(2-fluoro-4-iodoanilino)-2-N-(2-hydroxyethoxy)furo[3,2-c]pyridine-2,7-dicarboxamide (PubChem CID 59704749) has the molecular formula C17H14FIN4O5 and a molecular weight of 500.22 g/mol. Its IUPAC name is 3-(2-fluoro-4-iodoanilino)-2-N-(2-hydroxyethoxy)furo[3,2-c]pyridine-2,7-dicarboxamide.
| Compound Name | 3-(2-fluoro-4-iodoanilino)-2-N-(2-hydroxyethoxy)furo[3,2-c]pyridine-2,7-dicarboxamide |
|---|---|
| PubChem CID | 59704749 |
| Molecular Formula | C17H14FIN4O5 |
| Molecular Weight | 500.22 g/mol |
| Exact Mass | 500.00 |
| IUPAC Name | 3-(2-fluoro-4-iodoanilino)-2-N-(2-hydroxyethoxy)furo[3,2-c]pyridine-2,7-dicarboxamide |
| SMILES | NC(=O)c1cncc2c(Nc3ccc(I)cc3F)c(C(=O)NOCCO)oc12 |
| InChI | InChI=1S/C17H14FIN4O5/c18-11-5-8(19)1-2-12(11)22-13-9-6-21-7-10(16(20)25)14(9)28-15(13)17(26)23-27-4-3-24/h1-2,5-7,22,24H,3-4H2,(H2,20,25)(H,23,26) |
| InChIKey | GTSUXMZVVCWKBG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 139.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|