C18H16F3IN2O5 — CID 59348028
5-(1,3-dioxolan-2-yl)-3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)benzamide (PubChem CID 59348028) has the molecular formula C18H16F3IN2O5 and a molecular weight of 524.23 g/mol. Its IUPAC name is 5-(1,3-dioxolan-2-yl)-3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)benzamide.
| Compound Name | 5-(1,3-dioxolan-2-yl)-3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)benzamide |
|---|---|
| PubChem CID | 59348028 |
| Molecular Formula | C18H16F3IN2O5 |
| Molecular Weight | 524.23 g/mol |
| Exact Mass | 524.01 |
| IUPAC Name | 5-(1,3-dioxolan-2-yl)-3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)benzamide |
| SMILES | O=C(NOCCO)c1cc(C2OCCO2)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C18H16F3IN2O5/c19-12-7-9(22)1-2-13(12)23-16-11(17(26)24-29-4-3-25)8-10(14(20)15(16)21)18-27-5-6-28-18/h1-2,7-8,18,23,25H,3-6H2,(H,24,26) |
| InChIKey | GPKWLGVEFDMMAR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.23 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|