C21H21F3IN3O5 — CID 11330677
3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(E)-N-(2-hydroxyethoxy)-C-prop-2-enylcarbonimidoyl]benzamide (PubChem CID 11330677) has the molecular formula C21H21F3IN3O5 and a molecular weight of 579.31 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(E)-N-(2-hydroxyethoxy)-C-prop-2-enylcarbonimidoyl]benzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(E)-N-(2-hydroxyethoxy)-C-prop-2-enylcarbonimidoyl]benzamide |
|---|---|
| PubChem CID | 11330677 |
| Molecular Formula | C21H21F3IN3O5 |
| Molecular Weight | 579.31 g/mol |
| Exact Mass | 579.05 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(E)-N-(2-hydroxyethoxy)-C-prop-2-enylcarbonimidoyl]benzamide |
| SMILES | C=CC/C(=N\OCCO)c1cc(C(=O)NOCCO)c(Nc2ccc(I)cc2F)c(F)c1F |
| InChI | InChI=1S/C21H21F3IN3O5/c1-2-3-16(27-32-8-6-29)13-11-14(21(31)28-33-9-7-30)20(19(24)18(13)23)26-17-5-4-12(25)10-15(17)22/h2,4-5,10-11,26,29-30H,1,3,6-9H2,(H,28,31)/b27-16+ |
| InChIKey | CYCOECACUTUUOH-JVWAILMASA-N |
| XLogP | 3.39 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|