C19H18F3IN2O4 — CID 59348016
3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-(prop-2-enoxymethyl)benzamide (PubChem CID 59348016) has the molecular formula C19H18F3IN2O4 and a molecular weight of 522.26 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-(prop-2-enoxymethyl)benzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-(prop-2-enoxymethyl)benzamide |
|---|---|
| PubChem CID | 59348016 |
| Molecular Formula | C19H18F3IN2O4 |
| Molecular Weight | 522.26 g/mol |
| Exact Mass | 522.03 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-(prop-2-enoxymethyl)benzamide |
| SMILES | C=CCOCc1cc(C(=O)NOCCO)c(Nc2ccc(I)cc2F)c(F)c1F |
| InChI | InChI=1S/C19H18F3IN2O4/c1-2-6-28-10-11-8-13(19(27)25-29-7-5-26)18(17(22)16(11)21)24-15-4-3-12(23)9-14(15)20/h2-4,8-9,24,26H,1,5-7,10H2,(H,25,27) |
| InChIKey | GKGSPXYVGBGAET-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|