C20H22F3IN4O5 — CID 87260239
3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[[hydroxy-[3-(methylamino)-3-oxopropyl]amino]methyl]benzamide (PubChem CID 87260239) has the molecular formula C20H22F3IN4O5 and a molecular weight of 582.32 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[[hydroxy-[3-(methylamino)-3-oxopropyl]amino]methyl]benzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[[hydroxy-[3-(methylamino)-3-oxopropyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 87260239 |
| Molecular Formula | C20H22F3IN4O5 |
| Molecular Weight | 582.32 g/mol |
| Exact Mass | 582.06 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[[hydroxy-[3-(methylamino)-3-oxopropyl]amino]methyl]benzamide |
| SMILES | CNC(=O)CCN(O)Cc1cc(C(=O)NOCCO)c(Nc2ccc(I)cc2F)c(F)c1F |
| InChI | InChI=1S/C20H22F3IN4O5/c1-25-16(30)4-5-28(32)10-11-8-13(20(31)27-33-7-6-29)19(18(23)17(11)22)26-15-3-2-12(24)9-14(15)21/h2-3,8-9,26,29,32H,4-7,10H2,1H3,(H,25,30)(H,27,31) |
| InChIKey | GHLLBWTZCCHXFO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|