C20H21F3IN3O6 — CID 11376705
3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(E)-N-(2-hydroxyethoxy)-C-(2-hydroxyethyl)carbonimidoyl]benzamide (PubChem CID 11376705) has the molecular formula C20H21F3IN3O6 and a molecular weight of 583.30 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(E)-N-(2-hydroxyethoxy)-C-(2-hydroxyethyl)carbonimidoyl]benzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(E)-N-(2-hydroxyethoxy)-C-(2-hydroxyethyl)carbonimidoyl]benzamide |
|---|---|
| PubChem CID | 11376705 |
| Molecular Formula | C20H21F3IN3O6 |
| Molecular Weight | 583.30 g/mol |
| Exact Mass | 583.04 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(E)-N-(2-hydroxyethoxy)-C-(2-hydroxyethyl)carbonimidoyl]benzamide |
| SMILES | O=C(NOCCO)c1cc(/C(CCO)=N/OCCO)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C20H21F3IN3O6/c21-14-9-11(24)1-2-16(14)25-19-13(20(31)27-33-8-6-30)10-12(17(22)18(19)23)15(3-4-28)26-32-7-5-29/h1-2,9-10,25,28-30H,3-8H2,(H,27,31)/b26-15+ |
| InChIKey | GFFREICIQDLZSN-CVKSISIWSA-N |
| XLogP | 2.20 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|