C21H22FN3O6 — CID 143636044
ethyl 3-(2-fluoro-4-methylanilino)-2-(3-hydroxypropoxycarbamoyl)furo[3,2-c]pyridine-7-carboxylate (PubChem CID 143636044) has the molecular formula C21H22FN3O6 and a molecular weight of 431.42 g/mol. Its IUPAC name is ethyl 3-(2-fluoro-4-methylanilino)-2-(3-hydroxypropoxycarbamoyl)furo[3,2-c]pyridine-7-carboxylate.
| Compound Name | ethyl 3-(2-fluoro-4-methylanilino)-2-(3-hydroxypropoxycarbamoyl)furo[3,2-c]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 143636044 |
| Molecular Formula | C21H22FN3O6 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | ethyl 3-(2-fluoro-4-methylanilino)-2-(3-hydroxypropoxycarbamoyl)furo[3,2-c]pyridine-7-carboxylate |
| SMILES | CCOC(=O)c1cncc2c(Nc3ccc(C)cc3F)c(C(=O)NOCCCO)oc12 |
| InChI | InChI=1S/C21H22FN3O6/c1-3-29-21(28)14-11-23-10-13-17(24-16-6-5-12(2)9-15(16)22)19(31-18(13)14)20(27)25-30-8-4-7-26/h5-6,9-11,24,26H,3-4,7-8H2,1-2H3,(H,25,27) |
| InChIKey | BWROOCYRWANMAA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 122.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|