C21H23ClFN3O5 — CID 143636089
7-chloro-3-(2-fluoro-4-methylanilino)-N-[3-(2-hydroxypropan-2-yloxy)propoxy]furo[3,2-c]pyridine-2-carboxamide (PubChem CID 143636089) has the molecular formula C21H23ClFN3O5 and a molecular weight of 451.88 g/mol. Its IUPAC name is 7-chloro-3-(2-fluoro-4-methylanilino)-N-[3-(2-hydroxypropan-2-yloxy)propoxy]furo[3,2-c]pyridine-2-carboxamide.
| Compound Name | 7-chloro-3-(2-fluoro-4-methylanilino)-N-[3-(2-hydroxypropan-2-yloxy)propoxy]furo[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 143636089 |
| Molecular Formula | C21H23ClFN3O5 |
| Molecular Weight | 451.88 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 7-chloro-3-(2-fluoro-4-methylanilino)-N-[3-(2-hydroxypropan-2-yloxy)propoxy]furo[3,2-c]pyridine-2-carboxamide |
| SMILES | Cc1ccc(Nc2c(C(=O)NOCCCOC(C)(C)O)oc3c(Cl)cncc23)c(F)c1 |
| InChI | InChI=1S/C21H23ClFN3O5/c1-12-5-6-16(15(23)9-12)25-17-13-10-24-11-14(22)18(13)31-19(17)20(27)26-30-8-4-7-29-21(2,3)28/h5-6,9-11,25,28H,4,7-8H2,1-3H3,(H,26,27) |
| InChIKey | CTSHWODQKDKHHS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 105.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.88 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|