C26H32FN3O7Si — CID 59704739
ethyl 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxycarbamoyl]-3-(2-fluoro-4-trimethylsilylanilino)furo[3,2-c]pyridine-7-carboxylate (PubChem CID 59704739) has the molecular formula C26H32FN3O7Si and a molecular weight of 545.64 g/mol. Its IUPAC name is ethyl 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxycarbamoyl]-3-(2-fluoro-4-trimethylsilylanilino)furo[3,2-c]pyridine-7-carboxylate.
| Compound Name | ethyl 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxycarbamoyl]-3-(2-fluoro-4-trimethylsilylanilino)furo[3,2-c]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 59704739 |
| Molecular Formula | C26H32FN3O7Si |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | ethyl 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxycarbamoyl]-3-(2-fluoro-4-trimethylsilylanilino)furo[3,2-c]pyridine-7-carboxylate |
| SMILES | CCOC(=O)c1cncc2c(Nc3ccc([Si](C)(C)C)cc3F)c(C(=O)NOC[C@H]3COC(C)(C)O3)oc12 |
| InChI | InChI=1S/C26H32FN3O7Si/c1-7-33-25(32)18-12-28-11-17-21(29-20-9-8-16(10-19(20)27)38(4,5)6)23(36-22(17)18)24(31)30-35-14-15-13-34-26(2,3)37-15/h8-12,15,29H,7,13-14H2,1-6H3,(H,30,31)/t15-/m1/s1 |
| InChIKey | WWMNKLYZTHPRHY-OAHLLOKOSA-N |
| XLogP | 4.25 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|