C20H19BrFN3O4S — CID 59703895
3-(4-bromo-2-fluoroanilino)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]thieno[3,2-c]pyridine-2-carboxamide (PubChem CID 59703895) has the molecular formula C20H19BrFN3O4S and a molecular weight of 496.36 g/mol. Its IUPAC name is 3-(4-bromo-2-fluoroanilino)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]thieno[3,2-c]pyridine-2-carboxamide.
| Compound Name | 3-(4-bromo-2-fluoroanilino)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]thieno[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 59703895 |
| Molecular Formula | C20H19BrFN3O4S |
| Molecular Weight | 496.36 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | 3-(4-bromo-2-fluoroanilino)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]thieno[3,2-c]pyridine-2-carboxamide |
| SMILES | CC1(C)OC[C@H](CONC(=O)c2sc3ccncc3c2Nc2ccc(Br)cc2F)O1 |
| InChI | InChI=1S/C20H19BrFN3O4S/c1-20(2)27-9-12(29-20)10-28-25-19(26)18-17(13-8-23-6-5-16(13)30-18)24-15-4-3-11(21)7-14(15)22/h3-8,12,24H,9-10H2,1-2H3,(H,25,26)/t12-/m1/s1 |
| InChIKey | XXSKEYLUPAZYJQ-GFCCVEGCSA-N |
| XLogP | 4.75 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.36 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|