C21H22FIN4O4 — CID 146585149
N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2-(2-fluoro-4-iodoanilino)-1-methylpyrrolo[2,3-b]pyridine-3-carboxamide (PubChem CID 146585149) has the molecular formula C21H22FIN4O4 and a molecular weight of 540.33 g/mol. Its IUPAC name is N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2-(2-fluoro-4-iodoanilino)-1-methylpyrrolo[2,3-b]pyridine-3-carboxamide.
| Compound Name | N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2-(2-fluoro-4-iodoanilino)-1-methylpyrrolo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 146585149 |
| Molecular Formula | C21H22FIN4O4 |
| Molecular Weight | 540.33 g/mol |
| Exact Mass | 540.07 |
| IUPAC Name | N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2-(2-fluoro-4-iodoanilino)-1-methylpyrrolo[2,3-b]pyridine-3-carboxamide |
| SMILES | Cn1c(Nc2ccc(I)cc2F)c(C(=O)NOC[C@H]2COC(C)(C)O2)c2cccnc21 |
| InChI | InChI=1S/C21H22FIN4O4/c1-21(2)29-10-13(31-21)11-30-26-20(28)17-14-5-4-8-24-18(14)27(3)19(17)25-16-7-6-12(23)9-15(16)22/h4-9,13,25H,10-11H2,1-3H3,(H,26,28)/t13-/m1/s1 |
| InChIKey | CRLHZLWJRTWBLN-CYBMUJFWSA-N |
| XLogP | 3.87 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|