C20H19ClFIN4O4 — CID 86761944
5-chloro-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-7-(2-fluoro-4-iodoanilino)pyrrolo[1,2-c]pyrimidine-6-carboxamide (PubChem CID 86761944) has the molecular formula C20H19ClFIN4O4 and a molecular weight of 560.75 g/mol. Its IUPAC name is 5-chloro-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-7-(2-fluoro-4-iodoanilino)pyrrolo[1,2-c]pyrimidine-6-carboxamide.
| Compound Name | 5-chloro-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-7-(2-fluoro-4-iodoanilino)pyrrolo[1,2-c]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 86761944 |
| Molecular Formula | C20H19ClFIN4O4 |
| Molecular Weight | 560.75 g/mol |
| Exact Mass | 560.01 |
| IUPAC Name | 5-chloro-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-7-(2-fluoro-4-iodoanilino)pyrrolo[1,2-c]pyrimidine-6-carboxamide |
| SMILES | CC1(C)OC[C@H](CONC(=O)c2c(Cl)c3ccncn3c2Nc2ccc(I)cc2F)O1 |
| InChI | InChI=1S/C20H19ClFIN4O4/c1-20(2)29-8-12(31-20)9-30-26-19(28)16-17(21)15-5-6-24-10-27(15)18(16)25-14-4-3-11(23)7-13(14)22/h3-7,10,12,25H,8-9H2,1-2H3,(H,26,28)/t12-/m1/s1 |
| InChIKey | FXXMZXHYNNVIKV-GFCCVEGCSA-N |
| XLogP | 4.29 |
| TPSA | 86.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.75 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|