C20H20FIN4O4 — CID 162713257
N-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oxy]-2-(2-fluoro-4-iodoanilino)-1-methylpyrrolo[2,3-b]pyridine-3-carboxamide (PubChem CID 162713257) has the molecular formula C20H20FIN4O4 and a molecular weight of 526.31 g/mol. Its IUPAC name is N-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oxy]-2-(2-fluoro-4-iodoanilino)-1-methylpyrrolo[2,3-b]pyridine-3-carboxamide.
| Compound Name | N-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oxy]-2-(2-fluoro-4-iodoanilino)-1-methylpyrrolo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 162713257 |
| Molecular Formula | C20H20FIN4O4 |
| Molecular Weight | 526.31 g/mol |
| Exact Mass | 526.05 |
| IUPAC Name | N-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oxy]-2-(2-fluoro-4-iodoanilino)-1-methylpyrrolo[2,3-b]pyridine-3-carboxamide |
| SMILES | Cn1c(Nc2ccc(I)cc2F)c(C(=O)NO[C@H]2COC(C)(C)O2)c2cccnc21 |
| InChI | InChI=1S/C20H20FIN4O4/c1-20(2)28-10-15(29-20)30-25-19(27)16-12-5-4-8-23-17(12)26(3)18(16)24-14-7-6-11(22)9-13(14)21/h4-9,15,24H,10H2,1-3H3,(H,25,27)/t15-/m0/s1 |
| InChIKey | UJEFNNHCZKSCDO-HNNXBMFYSA-N |
| XLogP | 3.83 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.31 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|