C19H18FIN4O5 — CID 59704718
N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-5-(2-fluoro-4-iodoanilino)furo[2,3-d]pyrimidine-6-carboxamide (PubChem CID 59704718) has the molecular formula C19H18FIN4O5 and a molecular weight of 528.28 g/mol. Its IUPAC name is N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-5-(2-fluoro-4-iodoanilino)furo[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-5-(2-fluoro-4-iodoanilino)furo[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 59704718 |
| Molecular Formula | C19H18FIN4O5 |
| Molecular Weight | 528.28 g/mol |
| Exact Mass | 528.03 |
| IUPAC Name | N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-5-(2-fluoro-4-iodoanilino)furo[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CC1(C)OC[C@H](CONC(=O)c2oc3ncncc3c2Nc2ccc(I)cc2F)O1 |
| InChI | InChI=1S/C19H18FIN4O5/c1-19(2)27-7-11(30-19)8-28-25-17(26)16-15(12-6-22-9-23-18(12)29-16)24-14-4-3-10(21)5-13(14)20/h3-6,9,11,24H,7-8H2,1-2H3,(H,25,26)/t11-/m1/s1 |
| InChIKey | HPSGISPVBFQCEX-LLVKDONJSA-N |
| XLogP | 3.52 |
| TPSA | 107.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|