C20H18F2IN3O5 — CID 59704573
3-(2,5-difluoro-4-iodoanilino)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]furo[3,2-c]pyridine-2-carboxamide (PubChem CID 59704573) has the molecular formula C20H18F2IN3O5 and a molecular weight of 545.28 g/mol. Its IUPAC name is 3-(2,5-difluoro-4-iodoanilino)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]furo[3,2-c]pyridine-2-carboxamide.
| Compound Name | 3-(2,5-difluoro-4-iodoanilino)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]furo[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 59704573 |
| Molecular Formula | C20H18F2IN3O5 |
| Molecular Weight | 545.28 g/mol |
| Exact Mass | 545.03 |
| IUPAC Name | 3-(2,5-difluoro-4-iodoanilino)-N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]furo[3,2-c]pyridine-2-carboxamide |
| SMILES | CC1(C)OC[C@H](CONC(=O)c2oc3ccncc3c2Nc2cc(F)c(I)cc2F)O1 |
| InChI | InChI=1S/C20H18F2IN3O5/c1-20(2)28-8-10(31-20)9-29-26-19(27)18-17(11-7-24-4-3-16(11)30-18)25-15-6-12(21)14(23)5-13(15)22/h3-7,10,25H,8-9H2,1-2H3,(H,26,27)/t10-/m1/s1 |
| InChIKey | XBYCRXWZRGDAPX-SNVBAGLBSA-N |
| XLogP | 4.27 |
| TPSA | 94.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.28 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|