C21H22FN3O4S — CID 90959642
N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-7-(2-fluoro-4-methylanilino)-1,2-benzothiazole-6-carboxamide (PubChem CID 90959642) has the molecular formula C21H22FN3O4S and a molecular weight of 431.49 g/mol. Its IUPAC name is N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-7-(2-fluoro-4-methylanilino)-1,2-benzothiazole-6-carboxamide.
| Compound Name | N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-7-(2-fluoro-4-methylanilino)-1,2-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 90959642 |
| Molecular Formula | C21H22FN3O4S |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-7-(2-fluoro-4-methylanilino)-1,2-benzothiazole-6-carboxamide |
| SMILES | Cc1ccc(Nc2c(C(=O)NOCC3COC(C)(C)O3)ccc3cnsc23)c(F)c1 |
| InChI | InChI=1S/C21H22FN3O4S/c1-12-4-7-17(16(22)8-12)24-18-15(6-5-13-9-23-30-19(13)18)20(26)25-28-11-14-10-27-21(2,3)29-14/h4-9,14,24H,10-11H2,1-3H3,(H,25,26) |
| InChIKey | CHHMVWKEKFVLFV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|