C18H18FN3O2S2 — CID 143922188
7-(2-fluoro-4-methylsulfanylanilino)-N-propoxy-1,2-benzothiazole-6-carboxamide (PubChem CID 143922188) has the molecular formula C18H18FN3O2S2 and a molecular weight of 391.49 g/mol. Its IUPAC name is 7-(2-fluoro-4-methylsulfanylanilino)-N-propoxy-1,2-benzothiazole-6-carboxamide.
| Compound Name | 7-(2-fluoro-4-methylsulfanylanilino)-N-propoxy-1,2-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 143922188 |
| Molecular Formula | C18H18FN3O2S2 |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 7-(2-fluoro-4-methylsulfanylanilino)-N-propoxy-1,2-benzothiazole-6-carboxamide |
| SMILES | CCCONC(=O)c1ccc2cnsc2c1Nc1ccc(SC)cc1F |
| InChI | InChI=1S/C18H18FN3O2S2/c1-3-8-24-22-18(23)13-6-4-11-10-20-26-17(11)16(13)21-15-7-5-12(25-2)9-14(15)19/h4-7,9-10,21H,3,8H2,1-2H3,(H,22,23) |
| InChIKey | CCMDNEHPUGRDQI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|