C16H17BrFN3O2 — CID 143220419
2-bromo-5-(2-fluoro-4-methylanilino)-N-propoxypyridine-4-carboxamide (PubChem CID 143220419) has the molecular formula C16H17BrFN3O2 and a molecular weight of 382.23 g/mol. Its IUPAC name is 2-bromo-5-(2-fluoro-4-methylanilino)-N-propoxypyridine-4-carboxamide.
| Compound Name | 2-bromo-5-(2-fluoro-4-methylanilino)-N-propoxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 143220419 |
| Molecular Formula | C16H17BrFN3O2 |
| Molecular Weight | 382.23 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 2-bromo-5-(2-fluoro-4-methylanilino)-N-propoxypyridine-4-carboxamide |
| SMILES | CCCONC(=O)c1cc(Br)ncc1Nc1ccc(C)cc1F |
| InChI | InChI=1S/C16H17BrFN3O2/c1-3-6-23-21-16(22)11-8-15(17)19-9-14(11)20-13-5-4-10(2)7-12(13)18/h4-5,7-9,20H,3,6H2,1-2H3,(H,21,22) |
| InChIKey | RSAUFUIIPGNWKJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.23 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|