C18H24FN3O4 — CID 143666998
5-acetyl-2-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-1H-pyrrole-3-carboxamide;ethane (PubChem CID 143666998) has the molecular formula C18H24FN3O4 and a molecular weight of 365.41 g/mol. Its IUPAC name is 5-acetyl-2-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-1H-pyrrole-3-carboxamide;ethane.
| Compound Name | 5-acetyl-2-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-1H-pyrrole-3-carboxamide;ethane |
|---|---|
| PubChem CID | 143666998 |
| Molecular Formula | C18H24FN3O4 |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 5-acetyl-2-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-1H-pyrrole-3-carboxamide;ethane |
| SMILES | CC.CC(=O)c1cc(C(=O)NOCCO)c(Nc2ccc(C)cc2F)[nH]1 |
| InChI | InChI=1S/C16H18FN3O4.C2H6/c1-9-3-4-13(12(17)7-9)18-15-11(8-14(19-15)10(2)22)16(23)20-24-6-5-21;1-2/h3-4,7-8,18-19,21H,5-6H2,1-2H3,(H,20,23);1-2H3 |
| InChIKey | LBEWYHNOYXVSLT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|