C20H22F3N3O5 — CID 143019288
3,4-difluoro-2-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-5-[(E)-2-methoxyethoxyiminomethyl]benzamide (PubChem CID 143019288) has the molecular formula C20H22F3N3O5 and a molecular weight of 441.41 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-5-[(E)-2-methoxyethoxyiminomethyl]benzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-5-[(E)-2-methoxyethoxyiminomethyl]benzamide |
|---|---|
| PubChem CID | 143019288 |
| Molecular Formula | C20H22F3N3O5 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-5-[(E)-2-methoxyethoxyiminomethyl]benzamide |
| SMILES | COCCO/N=C/c1cc(C(=O)NOCCO)c(Nc2ccc(C)cc2F)c(F)c1F |
| InChI | InChI=1S/C20H22F3N3O5/c1-12-3-4-16(15(21)9-12)25-19-14(20(28)26-31-6-5-27)10-13(17(22)18(19)23)11-24-30-8-7-29-2/h3-4,9-11,25,27H,5-8H2,1-2H3,(H,26,28)/b24-11+ |
| InChIKey | FJHDOFHGXWMCIA-BHGWPJFGSA-N |
| XLogP | 2.81 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|