C17H17FN4O2 — CID 142476362
2-(2-fluoro-4-methylanilino)-N-methoxy-1-methylpyrrolo[2,3-b]pyridine-3-carboxamide (PubChem CID 142476362) has the molecular formula C17H17FN4O2 and a molecular weight of 328.35 g/mol. Its IUPAC name is 2-(2-fluoro-4-methylanilino)-N-methoxy-1-methylpyrrolo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 2-(2-fluoro-4-methylanilino)-N-methoxy-1-methylpyrrolo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142476362 |
| Molecular Formula | C17H17FN4O2 |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2-(2-fluoro-4-methylanilino)-N-methoxy-1-methylpyrrolo[2,3-b]pyridine-3-carboxamide |
| SMILES | CONC(=O)c1c(Nc2ccc(C)cc2F)n(C)c2ncccc12 |
| InChI | InChI=1S/C17H17FN4O2/c1-10-6-7-13(12(18)9-10)20-16-14(17(23)21-24-3)11-5-4-8-19-15(11)22(16)2/h4-9,20H,1-3H3,(H,21,23) |
| InChIKey | IFUJDMOTCYRDTJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|