C20H22FN3O5 — CID 123636689
6-(2-fluoro-4-methylanilino)-N-(2-hydroxybutoxy)-5-methyl-4-oxofuro[3,2-c]pyridine-7-carboxamide (PubChem CID 123636689) has the molecular formula C20H22FN3O5 and a molecular weight of 403.41 g/mol. Its IUPAC name is 6-(2-fluoro-4-methylanilino)-N-(2-hydroxybutoxy)-5-methyl-4-oxofuro[3,2-c]pyridine-7-carboxamide.
| Compound Name | 6-(2-fluoro-4-methylanilino)-N-(2-hydroxybutoxy)-5-methyl-4-oxofuro[3,2-c]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 123636689 |
| Molecular Formula | C20H22FN3O5 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 6-(2-fluoro-4-methylanilino)-N-(2-hydroxybutoxy)-5-methyl-4-oxofuro[3,2-c]pyridine-7-carboxamide |
| SMILES | CCC(O)CONC(=O)c1c(Nc2ccc(C)cc2F)n(C)c(=O)c2ccoc12 |
| InChI | InChI=1S/C20H22FN3O5/c1-4-12(25)10-29-23-19(26)16-17-13(7-8-28-17)20(27)24(3)18(16)22-15-6-5-11(2)9-14(15)21/h5-9,12,22,25H,4,10H2,1-3H3,(H,23,26) |
| InChIKey | HOOQSZPYEZKANB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 105.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|