C23H27FN4O6 — CID 123951183
6-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-5-methyl-2-(morpholin-4-ylmethyl)-4-oxofuro[3,2-c]pyridine-7-carboxamide (PubChem CID 123951183) has the molecular formula C23H27FN4O6 and a molecular weight of 474.49 g/mol. Its IUPAC name is 6-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-5-methyl-2-(morpholin-4-ylmethyl)-4-oxofuro[3,2-c]pyridine-7-carboxamide.
| Compound Name | 6-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-5-methyl-2-(morpholin-4-ylmethyl)-4-oxofuro[3,2-c]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 123951183 |
| Molecular Formula | C23H27FN4O6 |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 6-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-5-methyl-2-(morpholin-4-ylmethyl)-4-oxofuro[3,2-c]pyridine-7-carboxamide |
| SMILES | Cc1ccc(Nc2c(C(=O)NOCCO)c3oc(CN4CCOCC4)cc3c(=O)n2C)c(F)c1 |
| InChI | InChI=1S/C23H27FN4O6/c1-14-3-4-18(17(24)11-14)25-21-19(22(30)26-33-10-7-29)20-16(23(31)27(21)2)12-15(34-20)13-28-5-8-32-9-6-28/h3-4,11-12,25,29H,5-10,13H2,1-2H3,(H,26,30) |
| InChIKey | FDHNJDYNOPUXBA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|