C21H24FN5O3 — CID 143686852
7-cyano-3-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-1-methylpyrrolo[3,2-c]pyridine-2-carboxamide;ethane (PubChem CID 143686852) has the molecular formula C21H24FN5O3 and a molecular weight of 413.45 g/mol. Its IUPAC name is 7-cyano-3-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-1-methylpyrrolo[3,2-c]pyridine-2-carboxamide;ethane.
| Compound Name | 7-cyano-3-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-1-methylpyrrolo[3,2-c]pyridine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 143686852 |
| Molecular Formula | C21H24FN5O3 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 7-cyano-3-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-1-methylpyrrolo[3,2-c]pyridine-2-carboxamide;ethane |
| SMILES | CC.Cc1ccc(Nc2c(C(=O)NOCCO)n(C)c3c(C#N)cncc23)c(F)c1 |
| InChI | InChI=1S/C19H18FN5O3.C2H6/c1-11-3-4-15(14(20)7-11)23-16-13-10-22-9-12(8-21)17(13)25(2)18(16)19(27)24-28-6-5-26;1-2/h3-4,7,9-10,23,26H,5-6H2,1-2H3,(H,24,27);1-2H3 |
| InChIKey | TWZPCKDLWZHKHE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|