C27H28FN5O4 — CID 143686646
1-[[3-(dimethylcarbamoyl)phenyl]methyl]-3-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)pyrrolo[3,2-c]pyridine-2-carboxamide (PubChem CID 143686646) has the molecular formula C27H28FN5O4 and a molecular weight of 505.55 g/mol. Its IUPAC name is 1-[[3-(dimethylcarbamoyl)phenyl]methyl]-3-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)pyrrolo[3,2-c]pyridine-2-carboxamide.
| Compound Name | 1-[[3-(dimethylcarbamoyl)phenyl]methyl]-3-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)pyrrolo[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 143686646 |
| Molecular Formula | C27H28FN5O4 |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | 1-[[3-(dimethylcarbamoyl)phenyl]methyl]-3-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)pyrrolo[3,2-c]pyridine-2-carboxamide |
| SMILES | Cc1ccc(Nc2c(C(=O)NOCCO)n(Cc3cccc(C(=O)N(C)C)c3)c3ccncc23)c(F)c1 |
| InChI | InChI=1S/C27H28FN5O4/c1-17-7-8-22(21(28)13-17)30-24-20-15-29-10-9-23(20)33(25(24)26(35)31-37-12-11-34)16-18-5-4-6-19(14-18)27(36)32(2)3/h4-10,13-15,30,34H,11-12,16H2,1-3H3,(H,31,35) |
| InChIKey | AOJYFQPORONMCA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|