C17H16F2N4O3 — CID 143826352
6-fluoro-8-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)pyrrolo[1,2-a]pyrazine-7-carboxamide (PubChem CID 143826352) has the molecular formula C17H16F2N4O3 and a molecular weight of 362.34 g/mol. Its IUPAC name is 6-fluoro-8-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)pyrrolo[1,2-a]pyrazine-7-carboxamide.
| Compound Name | 6-fluoro-8-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)pyrrolo[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 143826352 |
| Molecular Formula | C17H16F2N4O3 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 6-fluoro-8-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)pyrrolo[1,2-a]pyrazine-7-carboxamide |
| SMILES | Cc1ccc(Nc2c(C(=O)NOCCO)c(F)n3ccncc23)c(F)c1 |
| InChI | InChI=1S/C17H16F2N4O3/c1-10-2-3-12(11(18)8-10)21-15-13-9-20-4-5-23(13)16(19)14(15)17(25)22-26-7-6-24/h2-5,8-9,21,24H,6-7H2,1H3,(H,22,25) |
| InChIKey | FLSZGPFRKCEJAF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|