C19H20FN3O4S — CID 142476290
N-(2,3-dihydroxypropoxy)-2-(2-fluoro-4-methylanilino)-5-methylthieno[2,3-b]pyridine-3-carboxamide (PubChem CID 142476290) has the molecular formula C19H20FN3O4S and a molecular weight of 405.45 g/mol. Its IUPAC name is N-(2,3-dihydroxypropoxy)-2-(2-fluoro-4-methylanilino)-5-methylthieno[2,3-b]pyridine-3-carboxamide.
| Compound Name | N-(2,3-dihydroxypropoxy)-2-(2-fluoro-4-methylanilino)-5-methylthieno[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142476290 |
| Molecular Formula | C19H20FN3O4S |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | N-(2,3-dihydroxypropoxy)-2-(2-fluoro-4-methylanilino)-5-methylthieno[2,3-b]pyridine-3-carboxamide |
| SMILES | Cc1ccc(Nc2sc3ncc(C)cc3c2C(=O)NOCC(O)CO)c(F)c1 |
| InChI | InChI=1S/C19H20FN3O4S/c1-10-3-4-15(14(20)6-10)22-19-16(17(26)23-27-9-12(25)8-24)13-5-11(2)7-21-18(13)28-19/h3-7,12,22,24-25H,8-9H2,1-2H3,(H,23,26) |
| InChIKey | ZWSBQZOCZYOONC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|