C17H18FN5O3 — CID 129073413
5-(2-fluoro-4-methylanilino)-N-[(2S)-2-hydroxypropoxy]imidazo[1,5-a]pyrazine-6-carboxamide (PubChem CID 129073413) has the molecular formula C17H18FN5O3 and a molecular weight of 359.36 g/mol. Its IUPAC name is 5-(2-fluoro-4-methylanilino)-N-[(2S)-2-hydroxypropoxy]imidazo[1,5-a]pyrazine-6-carboxamide.
| Compound Name | 5-(2-fluoro-4-methylanilino)-N-[(2S)-2-hydroxypropoxy]imidazo[1,5-a]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 129073413 |
| Molecular Formula | C17H18FN5O3 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 5-(2-fluoro-4-methylanilino)-N-[(2S)-2-hydroxypropoxy]imidazo[1,5-a]pyrazine-6-carboxamide |
| SMILES | Cc1ccc(Nc2c(C(=O)NOC[C@H](C)O)ncc3cncn23)c(F)c1 |
| InChI | InChI=1S/C17H18FN5O3/c1-10-3-4-14(13(18)5-10)21-16-15(17(25)22-26-8-11(2)24)20-7-12-6-19-9-23(12)16/h3-7,9,11,21,24H,8H2,1-2H3,(H,22,25)/t11-/m0/s1 |
| InChIKey | WEHJWTBAEGDJSG-NSHDSACASA-N |
| XLogP | 1.96 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|