C20H24FN5O3 — CID 143830516
ethane;N-(2-ethenoxyethoxy)-5-(2-fluoro-4-methylanilino)imidazo[1,5-a]pyrazine-6-carboxamide (PubChem CID 143830516) has the molecular formula C20H24FN5O3 and a molecular weight of 401.44 g/mol. Its IUPAC name is ethane;N-(2-ethenoxyethoxy)-5-(2-fluoro-4-methylanilino)imidazo[1,5-a]pyrazine-6-carboxamide.
| Compound Name | ethane;N-(2-ethenoxyethoxy)-5-(2-fluoro-4-methylanilino)imidazo[1,5-a]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 143830516 |
| Molecular Formula | C20H24FN5O3 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | ethane;N-(2-ethenoxyethoxy)-5-(2-fluoro-4-methylanilino)imidazo[1,5-a]pyrazine-6-carboxamide |
| SMILES | C=COCCONC(=O)c1ncc2cncn2c1Nc1ccc(C)cc1F.CC |
| InChI | InChI=1S/C18H18FN5O3.C2H6/c1-3-26-6-7-27-23-18(25)16-17(24-11-20-9-13(24)10-21-16)22-15-5-4-12(2)8-14(15)19;1-2/h3-5,8-11,22H,1,6-7H2,2H3,(H,23,25);1-2H3 |
| InChIKey | XYOLSNYTVXEIEI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|