C20H24FN3O2S — CID 142476271
ethane;N-ethoxy-2-(2-fluoro-4-methylanilino)-5-methylthieno[2,3-b]pyridine-3-carboxamide (PubChem CID 142476271) has the molecular formula C20H24FN3O2S and a molecular weight of 389.50 g/mol. Its IUPAC name is ethane;N-ethoxy-2-(2-fluoro-4-methylanilino)-5-methylthieno[2,3-b]pyridine-3-carboxamide.
| Compound Name | ethane;N-ethoxy-2-(2-fluoro-4-methylanilino)-5-methylthieno[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142476271 |
| Molecular Formula | C20H24FN3O2S |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | ethane;N-ethoxy-2-(2-fluoro-4-methylanilino)-5-methylthieno[2,3-b]pyridine-3-carboxamide |
| SMILES | CC.CCONC(=O)c1c(Nc2ccc(C)cc2F)sc2ncc(C)cc12 |
| InChI | InChI=1S/C18H18FN3O2S.C2H6/c1-4-24-22-16(23)15-12-7-11(3)9-20-17(12)25-18(15)21-14-6-5-10(2)8-13(14)19;1-2/h5-9,21H,4H2,1-3H3,(H,22,23);1-2H3 |
| InChIKey | BXEUYBOGWYRVHO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|