C20H20FN3O2S — CID 142476310
N-(cyclopropylmethoxy)-2-(2-fluoro-4-methylanilino)-6-methylthieno[2,3-b]pyridine-3-carboxamide (PubChem CID 142476310) has the molecular formula C20H20FN3O2S and a molecular weight of 385.46 g/mol. Its IUPAC name is N-(cyclopropylmethoxy)-2-(2-fluoro-4-methylanilino)-6-methylthieno[2,3-b]pyridine-3-carboxamide.
| Compound Name | N-(cyclopropylmethoxy)-2-(2-fluoro-4-methylanilino)-6-methylthieno[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142476310 |
| Molecular Formula | C20H20FN3O2S |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | N-(cyclopropylmethoxy)-2-(2-fluoro-4-methylanilino)-6-methylthieno[2,3-b]pyridine-3-carboxamide |
| SMILES | Cc1ccc(Nc2sc3nc(C)ccc3c2C(=O)NOCC2CC2)c(F)c1 |
| InChI | InChI=1S/C20H20FN3O2S/c1-11-3-8-16(15(21)9-11)23-20-17(18(25)24-26-10-13-5-6-13)14-7-4-12(2)22-19(14)27-20/h3-4,7-9,13,23H,5-6,10H2,1-2H3,(H,24,25) |
| InChIKey | NTCCTMKROXXVMQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|