C20H25FN2O5S — CID 167133101
5-acetyl-N-[(2S)-2,3-dihydroxypropoxy]-2-(2-fluoro-4-methylanilino)-4-propan-2-ylthiophene-3-carboxamide (PubChem CID 167133101) has the molecular formula C20H25FN2O5S and a molecular weight of 424.49 g/mol. Its IUPAC name is 5-acetyl-N-[(2S)-2,3-dihydroxypropoxy]-2-(2-fluoro-4-methylanilino)-4-propan-2-ylthiophene-3-carboxamide.
| Compound Name | 5-acetyl-N-[(2S)-2,3-dihydroxypropoxy]-2-(2-fluoro-4-methylanilino)-4-propan-2-ylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 167133101 |
| Molecular Formula | C20H25FN2O5S |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 5-acetyl-N-[(2S)-2,3-dihydroxypropoxy]-2-(2-fluoro-4-methylanilino)-4-propan-2-ylthiophene-3-carboxamide |
| SMILES | CC(=O)c1sc(Nc2ccc(C)cc2F)c(C(=O)NOC[C@@H](O)CO)c1C(C)C |
| InChI | InChI=1S/C20H25FN2O5S/c1-10(2)16-17(19(27)23-28-9-13(26)8-24)20(29-18(16)12(4)25)22-15-6-5-11(3)7-14(15)21/h5-7,10,13,22,24,26H,8-9H2,1-4H3,(H,23,27)/t13-/m0/s1 |
| InChIKey | POVCVORAXYKWIJ-ZDUSSCGKSA-N |
| XLogP | 3.28 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|