C17H19F3N2O4 — CID 91275168
N-(2,3-dihydroxypropoxy)-4,5-difluoro-6-(2-fluoro-4-methylanilino)cyclohexa-1,4-diene-1-carboxamide (PubChem CID 91275168) has the molecular formula C17H19F3N2O4 and a molecular weight of 372.34 g/mol. Its IUPAC name is N-(2,3-dihydroxypropoxy)-4,5-difluoro-6-(2-fluoro-4-methylanilino)cyclohexa-1,4-diene-1-carboxamide.
| Compound Name | N-(2,3-dihydroxypropoxy)-4,5-difluoro-6-(2-fluoro-4-methylanilino)cyclohexa-1,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 91275168 |
| Molecular Formula | C17H19F3N2O4 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-(2,3-dihydroxypropoxy)-4,5-difluoro-6-(2-fluoro-4-methylanilino)cyclohexa-1,4-diene-1-carboxamide |
| SMILES | Cc1ccc(NC2C(C(=O)NOCC(O)CO)=CCC(F)=C2F)c(F)c1 |
| InChI | InChI=1S/C17H19F3N2O4/c1-9-2-5-14(13(19)6-9)21-16-11(3-4-12(18)15(16)20)17(25)22-26-8-10(24)7-23/h2-3,5-6,10,16,21,23-24H,4,7-8H2,1H3,(H,22,25) |
| InChIKey | AHPRBEILNMRLPG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|