C18H17F2N3O5 — CID 123631940
N-(2,3-dihydroxypropoxy)-4-fluoro-5-(2-fluoro-4-methylanilino)-1,3-benzoxazole-6-carboxamide (PubChem CID 123631940) has the molecular formula C18H17F2N3O5 and a molecular weight of 393.35 g/mol. Its IUPAC name is N-(2,3-dihydroxypropoxy)-4-fluoro-5-(2-fluoro-4-methylanilino)-1,3-benzoxazole-6-carboxamide.
| Compound Name | N-(2,3-dihydroxypropoxy)-4-fluoro-5-(2-fluoro-4-methylanilino)-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 123631940 |
| Molecular Formula | C18H17F2N3O5 |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-(2,3-dihydroxypropoxy)-4-fluoro-5-(2-fluoro-4-methylanilino)-1,3-benzoxazole-6-carboxamide |
| SMILES | Cc1ccc(Nc2c(C(=O)NOCC(O)CO)cc3ocnc3c2F)c(F)c1 |
| InChI | InChI=1S/C18H17F2N3O5/c1-9-2-3-13(12(19)4-9)22-16-11(18(26)23-28-7-10(25)6-24)5-14-17(15(16)20)21-8-27-14/h2-5,8,10,22,24-25H,6-7H2,1H3,(H,23,26) |
| InChIKey | PENQUOLTQRLLSM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 116.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|