C21H31F3N2O2 — CID 164602895
3,4-difluoro-2-(2-fluoro-4-methylanilino)-N-methoxybenzamide;ethane (PubChem CID 164602895) has the molecular formula C21H31F3N2O2 and a molecular weight of 400.49 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-methylanilino)-N-methoxybenzamide;ethane.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-methylanilino)-N-methoxybenzamide;ethane |
|---|---|
| PubChem CID | 164602895 |
| Molecular Formula | C21H31F3N2O2 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-methylanilino)-N-methoxybenzamide;ethane |
| SMILES | CC.CC.CC.CONC(=O)c1ccc(F)c(F)c1Nc1ccc(C)cc1F |
| InChI | InChI=1S/C15H13F3N2O2.3C2H6/c1-8-3-6-12(11(17)7-8)19-14-9(15(21)20-22-2)4-5-10(16)13(14)18;3*1-2/h3-7,19H,1-2H3,(H,20,21);3*1-2H3 |
| InChIKey | DSMWVUMRYFYCGV-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|