C13H13FIN3O2 — CID 68785672
5-amino-6-(2-fluoro-4-iodoanilino)-4-methoxy-3-methyl-1H-pyridin-2-one (PubChem CID 68785672) has the molecular formula C13H13FIN3O2 and a molecular weight of 389.17 g/mol. Its IUPAC name is 5-amino-6-(2-fluoro-4-iodoanilino)-4-methoxy-3-methyl-1H-pyridin-2-one.
| Compound Name | 5-amino-6-(2-fluoro-4-iodoanilino)-4-methoxy-3-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 68785672 |
| Molecular Formula | C13H13FIN3O2 |
| Molecular Weight | 389.17 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | 5-amino-6-(2-fluoro-4-iodoanilino)-4-methoxy-3-methyl-1H-pyridin-2-one |
| SMILES | COc1c(N)c(Nc2ccc(I)cc2F)[nH]c(=O)c1C |
| InChI | InChI=1S/C13H13FIN3O2/c1-6-11(20-2)10(16)12(18-13(6)19)17-9-4-3-7(15)5-8(9)14/h3-5H,16H2,1-2H3,(H2,17,18,19) |
| InChIKey | RXQUFVFFMHQELH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.17 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|