C13H13FIN3O3 — CID 68807597
methyl 4-(2-fluoro-4-iodoanilino)-2-methyl-6-oxo-1,5-dihydropyridazine-3-carboxylate (PubChem CID 68807597) has the molecular formula C13H13FIN3O3 and a molecular weight of 405.17 g/mol. Its IUPAC name is methyl 4-(2-fluoro-4-iodoanilino)-2-methyl-6-oxo-1,5-dihydropyridazine-3-carboxylate.
| Compound Name | methyl 4-(2-fluoro-4-iodoanilino)-2-methyl-6-oxo-1,5-dihydropyridazine-3-carboxylate |
|---|---|
| PubChem CID | 68807597 |
| Molecular Formula | C13H13FIN3O3 |
| Molecular Weight | 405.17 g/mol |
| Exact Mass | 405.00 |
| IUPAC Name | methyl 4-(2-fluoro-4-iodoanilino)-2-methyl-6-oxo-1,5-dihydropyridazine-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2ccc(I)cc2F)CC(=O)NN1C |
| InChI | InChI=1S/C13H13FIN3O3/c1-18-12(13(20)21-2)10(6-11(19)17-18)16-9-4-3-7(15)5-8(9)14/h3-5,16H,6H2,1-2H3,(H,17,19) |
| InChIKey | HMYABYNHABUBBU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.17 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|