C13H10FIN2O3 — CID 174235320
4-(2-fluoro-4-iodoanilino)-5-methyl-6-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 174235320) has the molecular formula C13H10FIN2O3 and a molecular weight of 388.14 g/mol. Its IUPAC name is 4-(2-fluoro-4-iodoanilino)-5-methyl-6-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 4-(2-fluoro-4-iodoanilino)-5-methyl-6-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 174235320 |
| Molecular Formula | C13H10FIN2O3 |
| Molecular Weight | 388.14 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | 4-(2-fluoro-4-iodoanilino)-5-methyl-6-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | Cc1c(Nc2ccc(I)cc2F)c(C(=O)O)c[nH]c1=O |
| InChI | InChI=1S/C13H10FIN2O3/c1-6-11(8(13(19)20)5-16-12(6)18)17-10-3-2-7(15)4-9(10)14/h2-5H,1H3,(H,19,20)(H2,16,17,18) |
| InChIKey | ABQYXHOUVTUCDS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.14 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|