C14H14FIN2O — CID 122606005
4-(2-fluoro-4-iodoanilino)-1,3,5-trimethylpyridin-2-one (PubChem CID 122606005) has the molecular formula C14H14FIN2O and a molecular weight of 372.18 g/mol. Its IUPAC name is 4-(2-fluoro-4-iodoanilino)-1,3,5-trimethylpyridin-2-one.
| Compound Name | 4-(2-fluoro-4-iodoanilino)-1,3,5-trimethylpyridin-2-one |
|---|---|
| PubChem CID | 122606005 |
| Molecular Formula | C14H14FIN2O |
| Molecular Weight | 372.18 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 4-(2-fluoro-4-iodoanilino)-1,3,5-trimethylpyridin-2-one |
| SMILES | Cc1cn(C)c(=O)c(C)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C14H14FIN2O/c1-8-7-18(3)14(19)9(2)13(8)17-12-5-4-10(16)6-11(12)15/h4-7,17H,1-3H3 |
| InChIKey | VLNCHKHHLPNAKF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.18 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|