C16H17BrFN3O3 — CID 11395411
4-(4-bromo-2-fluoroanilino)-N-ethoxy-1,5-dimethyl-6-oxopyridine-3-carboxamide (PubChem CID 11395411) has the molecular formula C16H17BrFN3O3 and a molecular weight of 398.23 g/mol. Its IUPAC name is 4-(4-bromo-2-fluoroanilino)-N-ethoxy-1,5-dimethyl-6-oxopyridine-3-carboxamide.
| Compound Name | 4-(4-bromo-2-fluoroanilino)-N-ethoxy-1,5-dimethyl-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 11395411 |
| Molecular Formula | C16H17BrFN3O3 |
| Molecular Weight | 398.23 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | 4-(4-bromo-2-fluoroanilino)-N-ethoxy-1,5-dimethyl-6-oxopyridine-3-carboxamide |
| SMILES | CCONC(=O)c1cn(C)c(=O)c(C)c1Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C16H17BrFN3O3/c1-4-24-20-15(22)11-8-21(3)16(23)9(2)14(11)19-13-6-5-10(17)7-12(13)18/h5-8,19H,4H2,1-3H3,(H,20,22) |
| InChIKey | IKVITEMYFVVJFY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|